7-amino-4-chloro-3-ethoxyisochromen-1-one
Modify Date: 2025-10-23 21:50:20
7-amino-4-chloro-3-ethoxyisochromen-1-one structure
|
Common Name | 7-amino-4-chloro-3-ethoxyisochromen-1-one | ||
|---|---|---|---|---|
| CAS Number | 62252-30-6 | Molecular Weight | 239.65500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 7-amino-4-chloro-3-ethoxyisochromen-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H10ClNO3 |
|---|---|
| Molecular Weight | 239.65500 |
| Exact Mass | 239.03500 |
| PSA | 65.46000 |
| LogP | 3.00850 |
| InChIKey | OQPYHSIRELTTOU-UHFFFAOYSA-N |
| SMILES | CCOc1oc(=O)c2cc(N)ccc2c1Cl |
|
Name: Inhibition of gamma-secretase-mediated betaAPP K670N/M671L mutant cleavage in HEK293 ...
Source: ChEMBL
Target: Gamma-secretase subunit APH-1B
External Id: CHEMBL2344497
|
|
Name: Half-life for hydrolysis was determined from kinetic constant.
Source: ChEMBL
Target: N/A
External Id: CHEMBL636921
|
|
Name: Inhibition of human leukocyte elastase.
Source: ChEMBL
Target: Neutrophil elastase
External Id: CHEMBL678260
|
|
Name: Half life of the compound in hepes buffer
Source: ChEMBL
Target: N/A
External Id: CHEMBL2344039
|
|
Name: Second order inactivation rate constant for inhibition of human leukocyte elastase.
Source: ChEMBL
Target: Neutrophil elastase
External Id: CHEMBL674798
|
Total 5, Current Page 1 of 1
1
| 7-amino-4-chloro-3-ethoxyisocoumarin |
| 7-Amino-4-chlor-3-ethoxyisocumarin |
| 7-amino-3-ethoxy-4-chloroisocoumarin |
| 1H-2-Benzopyran-1-one,7-amino-4-chloro-3-ethoxy |
| 7-amino-4-chloro-3-ethoxy-isochromen-1-one |