lithium,methanidyl(diphenyl)phosphane structure
|
Common Name | lithium,methanidyl(diphenyl)phosphane | ||
|---|---|---|---|---|
| CAS Number | 62263-69-8 | Molecular Weight | 206.14900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H12LiP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | lithium,methanidyl(diphenyl)phosphane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H12LiP |
|---|---|
| Molecular Weight | 206.14900 |
| Exact Mass | 206.08400 |
| PSA | 13.59000 |
| LogP | 2.91090 |
| InChIKey | KSCXQUISXBCBKV-UHFFFAOYSA-N |
| SMILES | [CH2-]P(c1ccccc1)c1ccccc1.[Li+] |
|
~70%
lithium,methani... CAS#:62263-69-8 |
| Literature: van Doorn, J. A.; Meijboom, N. Phosphorus, Sulfur and Silicon and the Related Elements, 1989 , vol. 42, p. 211 - 222 |
| Diphenylphosphino-methyllithium |
| Lithiomethyl(diphenyl)phosphine |
| (lithiomethyl)diphenylphosphane |
| Lithium,[(diphenylphosphino)methyl] |
| Lithium methyldiphenylphosphine |
| lithium diphenylmethylphosphide |