lithium,ditert-butyl(methanidyl)phosphane
lithium,ditert-butyl(methanidyl)phosphane structure
|
Common Name | lithium,ditert-butyl(methanidyl)phosphane | ||
|---|---|---|---|---|
| CAS Number | 64065-07-2 | Molecular Weight | 166.17000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H20LiP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: Lithium,ditert-butyl(methanidyl)phosphane, Chinese name: 锂，二叔丁基甲基膦烷, CAS number: 64065-07-2, molecular formula: C9H20LiP, molecular weight: 166.17000. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | lithium,ditert-butyl(methanidyl)phosphane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H20LiP |
|---|---|
| Molecular Weight | 166.17000 |
| Exact Mass | 166.14600 |
| PSA | 13.59000 |
| LogP | 3.85690 |
| InChIKey | GKEDFFLJXSCVOI-UHFFFAOYSA-N |
| SMILES | [CH2-]P(C(C)(C)C)C(C)(C)C.[Li+] |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Methyl-di-tert-butyl-phosphin, lithium |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 64065-07-2? |
| A: Chinese name of 64065-07-2 is 64065-07-2. |
| Q: What is the polar surface area (PSA) of lithium,ditert-butyl(methanidyl)phosphane? |
| A: Polar surface area (PSA) of lithium,ditert-butyl(methanidyl)phosphane is 13.59000. |
| Q: What is the InChIKey of lithium,ditert-butyl(methanidyl)phosphane? |
| A: InChIKey of lithium,ditert-butyl(methanidyl)phosphane is GKEDFFLJXSCVOI-UHFFFAOYSA-N. |
| Q: What is the English name of lithium,ditert-butyl(methanidyl)phosphane? |
| A: The English name of lithium,ditert-butyl(methanidyl)phosphane is lithium,ditert-butyl(methanidyl)phosphane. |
| Q: What is the molecular formula of lithium,ditert-butyl(methanidyl)phosphane? |
| A: Molecular formula of lithium,ditert-butyl(methanidyl)phosphane is C9H20LiP. |
| Q: What is the CAS number of lithium,ditert-butyl(methanidyl)phosphane? |
| A: CAS number of lithium,ditert-butyl(methanidyl)phosphane is 64065-07-2. |
| Q: What English synonyms does lithium,ditert-butyl(methanidyl)phosphane have? |
| A: English synonyms of lithium,ditert-butyl(methanidyl)phosphane: Methyl-di-tert-butyl-phosphin, lithium. |
| Q: What is the LogP of lithium,ditert-butyl(methanidyl)phosphane? |
| A: LogP of lithium,ditert-butyl(methanidyl)phosphane is 3.85690. |
| Q: What is the SMILES notation of lithium,ditert-butyl(methanidyl)phosphane? |
| A: SMILES notation of lithium,ditert-butyl(methanidyl)phosphane is [CH2-]P(C(C)(C)C)C(C)(C)C.[Li+]. |
| Q: What is the molecular weight of lithium,ditert-butyl(methanidyl)phosphane? |
| A: Molecular weight of lithium,ditert-butyl(methanidyl)phosphane is 166.17000. |