methyl 2-trimethylsilyloxycyclohexene-1-carboxylate structure
|
Common Name | methyl 2-trimethylsilyloxycyclohexene-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 62269-47-0 | Molecular Weight | 228.36000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H20O3Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 2-trimethylsilyloxycyclohexene-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H20O3Si |
|---|---|
| Molecular Weight | 228.36000 |
| Exact Mass | 228.11800 |
| PSA | 35.53000 |
| LogP | 2.83900 |
| InChIKey | YICTZQVKGDOBNS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(O[Si](C)(C)C)CCCC1 |
|
~%
methyl 2-trimet... CAS#:62269-47-0 |
| Literature: Torkelson,S.; Ainsworth,C. Synthesis, 1976 , p. 722 - 724 |
|
~%
methyl 2-trimet... CAS#:62269-47-0 |
| Literature: Baidya, Mahiuddin; Yamamoto, Hisashi Journal of the American Chemical Society, 2011 , vol. 133, # 35 p. 13880 - 13882 |
| 1-Cyclohexene-1-carboxylic acid,2-[(trimethylsilyl)oxy]-,methyl ester |