phenyl 1,3-dimethylindene-1-carboxylate structure
|
Common Name | phenyl 1,3-dimethylindene-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 62291-81-0 | Molecular Weight | 264.31800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | phenyl 1,3-dimethylindene-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H16O2 |
|---|---|
| Molecular Weight | 264.31800 |
| Exact Mass | 264.11500 |
| PSA | 26.30000 |
| LogP | 3.96680 |
| InChIKey | ULGNJJLDFUUDHA-UHFFFAOYSA-N |
| SMILES | CC1=CC(C)(C(=O)Oc2ccccc2)c2ccccc21 |
|
~%
phenyl 1,3-dime... CAS#:62291-81-0 |
| Literature: Jones,D.W.; Kneen,G. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1977 , p. 1313 - 1320 |
| 1,3-Dimethyl-3-phenoxycarbonylinden |
| Phenyl-1,3-dimethylinden-1-carboxylat |
| 1H-Indene-1-carboxylic acid,1,3-dimethyl-,phenyl ester |