1-methyl-2-[(4-methylsulfinylphenoxy)methyl]-5-nitroimidazole
Modify Date: 2026-07-15 17:41:29
![1-methyl-2-[(4-methylsulfinylphenoxy)methyl]-5-nitroimidazole Structure](https://image.chemsrc.com/caspic/050/62351-99-9.png)
1-methyl-2-[(4-methylsulfinylphenoxy)methyl]-5-nitroimidazole structure
|
Common Name | 1-methyl-2-[(4-methylsulfinylphenoxy)methyl]-5-nitroimidazole | ||
|---|---|---|---|---|
| CAS Number | 62351-99-9 | Molecular Weight | 295.31400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H13N3O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-methyl-2-[(4-methylsulfinylphenoxy)methyl]-5-nitroimidazole |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H13N3O4S |
|---|---|
| Molecular Weight | 295.31400 |
| Exact Mass | 295.06300 |
| PSA | 109.15000 |
| LogP | 3.03360 |
| InChIKey | HBDLZYHJBXDDJM-UHFFFAOYSA-N |
| SMILES | Cn1c([N+](=O)[O-])cnc1COc1ccc(S(C)=O)cc1 |
|
~72%
1-methyl-2-[(4-... CAS#:62351-99-9 |
| Literature: Hoechst Aktiengesellschaft Patent: US4042705 A1, 1977 ; |
|
Name: Antimicrobial activity against Trypanosoma brucei NfxR2
Source: ChEMBL
Target: Trypanosoma brucei
External Id: CHEMBL1639021
|
|
Name: Selectivity ratio of EC50 for Trypanosoma brucei NfxR1 to EC50 for Trypanosoma brucei
Source: ChEMBL
Target: Trypanosoma brucei
External Id: CHEMBL1639022
|
|
Name: Selectivity ratio of EC50 for Trypanosoma brucei NfxR2 to EC50 for Trypanosoma brucei
Source: ChEMBL
Target: Trypanosoma brucei
External Id: CHEMBL1639023
|
Total 3, Current Page 1 of 1
1
| 1-Methyl-2-(4-methylsulfinyl-phenyl-oxymethyl)-5-nitro-imidazole |
| 2-(4-methanesulfinyl-phenoxymethyl)-1-methyl-5-nitro-1H-imidazole |
| Fexinidazole Sulfoxide |
| 1H-Imidazole,1-methyl-2-[[4-(methylsulfinyl)phenoxy]methyl]-5-nitro |