1-ACETYL-5-BROMO-7-NITROINDOLINE structure
|
Common Name | 1-ACETYL-5-BROMO-7-NITROINDOLINE | ||
|---|---|---|---|---|
| CAS Number | 62368-07-4 | Molecular Weight | 285.09400 | |
| Density | 1.688g/cm3 | Boiling Point | 482.8ºC at 760 mmHg | |
| Molecular Formula | C10H9BrN2O3 | Melting Point | 196-198°C | |
| MSDS | Chinese USA | Flash Point | 245.8ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1-Acetyl-5-bromo-7-nitroindoline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.688g/cm3 |
|---|---|
| Boiling Point | 482.8ºC at 760 mmHg |
| Melting Point | 196-198°C |
| Molecular Formula | C10H9BrN2O3 |
| Molecular Weight | 285.09400 |
| Flash Point | 245.8ºC |
| Exact Mass | 283.98000 |
| PSA | 66.13000 |
| LogP | 2.85450 |
| Index of Refraction | 1.639 |
| InChIKey | RCELVCGNAKOBPO-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CCc2cc(Br)cc([N+](=O)[O-])c21 |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H319 |
| Precautionary Statements | P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R22 |
| Safety Phrases | S36/37 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| Packaging Group | III |
| HS Code | 2933990090 |
|
~91%
1-ACETYL-5-BROM... CAS#:62368-07-4 |
| Literature: Mortensen, Michael B.; Kamounah, Fadhil S.; Christensen, Jorn B. Organic Preparations and Procedures International, 1996 , vol. 28, # 1 p. 123 - 125 |
|
~%
1-ACETYL-5-BROM... CAS#:62368-07-4 |
| Literature: Chemical and Pharmaceutical Bulletin, , vol. 48, # 6 p. 817 - 827 |
|
~%
1-ACETYL-5-BROM... CAS#:62368-07-4 |
| Literature: Chemical and Pharmaceutical Bulletin, , vol. 48, # 6 p. 817 - 827 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(5-bromo-7-nitro-2,3-dihydroindol-1-yl)ethanone |
| MFCD00056018 |