6-(3-bromophenyl)-9-(3,4-dimethoxyphenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one structure
|
Common Name | 6-(3-bromophenyl)-9-(3,4-dimethoxyphenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one | ||
|---|---|---|---|---|
| CAS Number | 6239-53-8 | Molecular Weight | 505.40300 | |
| Density | 1.45g/cm3 | Boiling Point | 643.3ºC at 760 mmHg | |
| Molecular Formula | C27H25BrN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 342.8ºC | |
| Name | 6-(3-bromophenyl)-9-(3,4-dimethoxyphenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.45g/cm3 |
|---|---|
| Boiling Point | 643.3ºC at 760 mmHg |
| Molecular Formula | C27H25BrN2O3 |
| Molecular Weight | 505.40300 |
| Flash Point | 342.8ºC |
| Exact Mass | 504.10500 |
| PSA | 59.59000 |
| LogP | 6.72180 |
| Index of Refraction | 1.681 |
| InChIKey | FZNDIGWTTRIPRM-UHFFFAOYSA-N |
| SMILES | COc1ccc(C2CC(=O)C3=C(C2)Nc2ccccc2NC3c2cccc(Br)c2)cc1OC |
|
~%
6-(3-bromopheny... CAS#:6239-53-8 |
| Literature: Beer et al. Journal of the Chemical Society, 1951 , p. 2029,2031 |
|
~%
6-(3-bromopheny... CAS#:6239-53-8 |
| Literature: Beer et al. Journal of the Chemical Society, 1951 , p. 2029,2031 |
| 5-Hydroxy-2,6-dimethylindol |
| 2,6-dimethyl-indol-5-ol |
| HMS604I12 |