(5-phenylthiophen-2-yl)-piperidin-1-ylmethanone structure
|
Common Name | (5-phenylthiophen-2-yl)-piperidin-1-ylmethanone | ||
|---|---|---|---|---|
| CAS Number | 62404-17-5 | Molecular Weight | 271.37700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H17NOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (5-phenylthiophen-2-yl)-piperidin-1-ylmethanone |
|---|
| Molecular Formula | C16H17NOS |
|---|---|
| Molecular Weight | 271.37700 |
| Exact Mass | 271.10300 |
| PSA | 48.55000 |
| LogP | 3.97910 |
| InChIKey | FSIWHZKYZKSONT-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(-c2ccccc2)s1)N1CCCCC1 |
|
~17%
(5-phenylthioph... CAS#:62404-17-5 |
| Literature: Okazawa, Toru; Satoh, Tetsuya; Miura, Masahiro; Nomura, Masakatsu Journal of the American Chemical Society, 2002 , vol. 124, # 19 p. 5286 - 5287 |
|
~%
(5-phenylthioph... CAS#:62404-17-5 |
| Literature: Steinkopf; Gording Biochemische Zeitschrift, 1937 , vol. 292, p. 368 |
|
~%
(5-phenylthioph... CAS#:62404-17-5 |
| Literature: Steinkopf; Gording Biochemische Zeitschrift, 1937 , vol. 292, p. 368 |
|
~%
(5-phenylthioph... CAS#:62404-17-5 |
| Literature: Steinkopf; Gording Biochemische Zeitschrift, 1937 , vol. 292, p. 368 |