bis[4-(2,4,4-trimethylpentan-2-yl)phenyl] hexanedioate structure
|
Common Name | bis[4-(2,4,4-trimethylpentan-2-yl)phenyl] hexanedioate | ||
|---|---|---|---|---|
| CAS Number | 62421-94-7 | Molecular Weight | 522.75800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C34H50O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | bis[4-(2,4,4-trimethylpentan-2-yl)phenyl] hexanedioate |
|---|
| Molecular Formula | C34H50O4 |
|---|---|
| Molecular Weight | 522.75800 |
| Exact Mass | 522.37100 |
| PSA | 52.60000 |
| LogP | 9.18560 |
| InChIKey | SZONIHPQSYNFGK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(OC(=O)CCCCC(=O)Oc2ccc(C(C)(C)CC(C)(C)C)cc2)cc1 |
|
~%
bis[4-(2,4,4-tr... CAS#:62421-94-7 |
| Literature: Portnoy et al. Journal of Chemical and Engineering Data, 1958 , vol. 3, p. 287 |