1-(2-hydroxy-2-phenylpropyl)-1,3,3-trimethylurea
Modify Date: 2025-09-26 16:28:18
1-(2-hydroxy-2-phenylpropyl)-1,3,3-trimethylurea structure
|
Common Name | 1-(2-hydroxy-2-phenylpropyl)-1,3,3-trimethylurea | ||
|---|---|---|---|---|
| CAS Number | 62432-70-6 | Molecular Weight | 236.31000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H20N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(2-hydroxy-2-phenylpropyl)-1,3,3-trimethylurea |
|---|
| Molecular Formula | C13H20N2O2 |
|---|---|
| Molecular Weight | 236.31000 |
| Exact Mass | 236.15200 |
| PSA | 43.78000 |
| LogP | 1.50750 |
| InChIKey | FAHCRIWYBQZSLI-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)N(C)CC(C)(O)c1ccccc1 |
|
~%
1-(2-hydroxy-2-... CAS#:62432-70-6 |
| Literature: Tsujimoto,Y. et al. Bulletin of the Chemical Society of Japan, 1976 , vol. 49, p. 3705 - 3706 |
