1-(2-hydroxy-2-phenylethyl)-1,3,3-trimethylurea
Modify Date: 2025-09-18 15:19:50
1-(2-hydroxy-2-phenylethyl)-1,3,3-trimethylurea structure
|
Common Name | 1-(2-hydroxy-2-phenylethyl)-1,3,3-trimethylurea | ||
|---|---|---|---|---|
| CAS Number | 62432-71-7 | Molecular Weight | 222.28400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H18N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(2-hydroxy-2-phenylethyl)-1,3,3-trimethylurea |
|---|
| Molecular Formula | C12H18N2O2 |
|---|---|
| Molecular Weight | 222.28400 |
| Exact Mass | 222.13700 |
| PSA | 43.78000 |
| LogP | 1.33340 |
| InChIKey | ZAYMVTWHSANHAN-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)N(C)CC(O)c1ccccc1 |
|
~%
1-(2-hydroxy-2-... CAS#:62432-71-7 |
| Literature: Tsujimoto,Y. et al. Bulletin of the Chemical Society of Japan, 1976 , vol. 49, p. 3705 - 3706 |
