7H-Furo[3, 2-g][1]benzopyran-7-one, 3-(methoxymethyl)-2,5,9-trimethyl- structure
|
Common Name | 7H-Furo[3, 2-g][1]benzopyran-7-one, 3-(methoxymethyl)-2,5,9-trimethyl- | ||
|---|---|---|---|---|
| CAS Number | 62442-60-8 | Molecular Weight | 272.29600 | |
| Density | 1.217g/cm3 | Boiling Point | 422.4ºC at 760 mmHg | |
| Molecular Formula | C16H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209.3ºC | |
| Name | 3-(methoxymethyl)-2,5,9-trimethylfuro[3,2-g]chromen-7-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.217g/cm3 |
|---|---|
| Boiling Point | 422.4ºC at 760 mmHg |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.29600 |
| Flash Point | 209.3ºC |
| Exact Mass | 272.10500 |
| PSA | 52.58000 |
| LogP | 3.61080 |
| Index of Refraction | 1.59 |
| InChIKey | UPAKHQWBZFCLMG-UHFFFAOYSA-N |
| SMILES | COCc1c(C)oc2c(C)c3oc(=O)cc(C)c3cc12 |
|
~99%
7H-Furo[3, 2-g]... CAS#:62442-60-8 |
| Literature: Hoffmann-La Roche Inc. Patent: US4124598 A1, 1978 ; |
|
~%
7H-Furo[3, 2-g]... CAS#:62442-60-8 |
| Literature: Wulff, Heike; Rauer, Heiko; Duering, Tim; Hanselmann, Christine; Ruff, Katharina; Wrisch, Anja; Grissmer, Stephan; Haensel, Wolfram Journal of Medicinal Chemistry, 1998 , vol. 41, # 23 p. 4542 - 4549 |
|
~%
7H-Furo[3, 2-g]... CAS#:62442-60-8 |
| Literature: Wulff, Heike; Rauer, Heiko; Duering, Tim; Hanselmann, Christine; Ruff, Katharina; Wrisch, Anja; Grissmer, Stephan; Haensel, Wolfram Journal of Medicinal Chemistry, 1998 , vol. 41, # 23 p. 4542 - 4549 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3-(Methoxymethyl)-2,5,9-trimethyl-7H-furo(3,2-g)(1)benzopyran-7-one |
| WLN: T C566 DO LVOJ B1 E1 F1O1 J1 |
| 7H-Furo[3,3-(methoxymethyl)-2,5,9-trimethyl |
| 3-methoxymethyl-2,5,9-trimethyl-furo[3,2-g]chromen-7-one |
| 4'-Methoxymethyl-4,5'8-trimethylpsoralen |