1-methyl-5H-pyrido[4,3-b]indol-3-amine structure
|
Common Name | 1-methyl-5H-pyrido[4,3-b]indol-3-amine | ||
|---|---|---|---|---|
| CAS Number | 62450-07-1 | Molecular Weight | 197.23600 | |
| Density | 1.3g/cm3 | Boiling Point | 337.6ºC at 760 mmHg | |
| Molecular Formula | C12H11N3 | Melting Point | >300ºC | |
| MSDS | N/A | Flash Point | 158ºC | |
| Name | 1-methyl-5H-pyrido[4,3-b]indol-3-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 337.6ºC at 760 mmHg |
| Melting Point | >300ºC |
| Molecular Formula | C12H11N3 |
| Molecular Weight | 197.23600 |
| Flash Point | 158ºC |
| Exact Mass | 197.09500 |
| PSA | 55.43000 |
| LogP | 2.53680 |
| Index of Refraction | 1.705 |
| InChIKey | LKKMLIBUAXYLOY-UHFFFAOYSA-N |
| SMILES | Cc1nc(N)cc2[nH]c3ccccc3c12 |
| RIDADR | UN 2811 |
|---|---|
| Packaging Group | III |
| Hazard Class | 6.1(b) |
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Trytophan pyrolysate 2 |
| Tryptophan pyrolysis product ii |
| Tryptophan P2 |
| 3-amino-1-methyl-5H-pyrido<3,4-b>indole |
| 4,3-b>Trp-2 |
| Rp-P-2 |
| Trp-P-2 |