5H-Pyrido(4,3-b)indole-3-carboxylic acid, 1-methyl- structure
|
Common Name | 5H-Pyrido(4,3-b)indole-3-carboxylic acid, 1-methyl- | ||
|---|---|---|---|---|
| CAS Number | 65032-81-7 | Molecular Weight | 226.23100 | |
| Density | 1.431g/cm3 | Boiling Point | 520.3ºC at 760 mmHg | |
| Molecular Formula | C13H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 268.5ºC | |
| Name | 1-methyl-5H-pyrido[4,3-b]indole-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.431g/cm3 |
|---|---|
| Boiling Point | 520.3ºC at 760 mmHg |
| Molecular Formula | C13H10N2O2 |
| Molecular Weight | 226.23100 |
| Flash Point | 268.5ºC |
| Exact Mass | 226.07400 |
| PSA | 65.98000 |
| LogP | 2.72270 |
| Index of Refraction | 1.778 |
| InChIKey | DAGDMYMXVFRKPZ-UHFFFAOYSA-N |
| SMILES | Cc1nc(C(=O)O)cc2[nH]c3ccccc3c12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Methyl-5H-pyrido(4,3-b)indole-3-carboxylic acid |
| 1-Methyl-5H-pyrido<4,3-b>indol-3-carbonsaeure |
| 5H-Pyrido[4,3-b]indole-3-carboxylicacid,1-methyl |