2-(4-ethylphenyl)benzo[f][1]benzofuran-4,9-dione structure
|
Common Name | 2-(4-ethylphenyl)benzo[f][1]benzofuran-4,9-dione | ||
|---|---|---|---|---|
| CAS Number | 62452-65-7 | Molecular Weight | 302.32300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4-ethylphenyl)benzo[f][1]benzofuran-4,9-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H14O3 |
|---|---|
| Molecular Weight | 302.32300 |
| Exact Mass | 302.09400 |
| PSA | 47.28000 |
| LogP | 4.28440 |
| InChIKey | HNPYCJFLHNFZHY-UHFFFAOYSA-N |
| SMILES | CCc1ccc(-c2cc3c(o2)C(=O)c2ccccc2C3=O)cc1 |
|
~%
2-(4-ethylpheny... CAS#:62452-65-7 |
| Literature: Otsuki,T. Bulletin of the Chemical Society of Japan, 1976 , vol. 49, p. 3713 - 3714 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-p-Aethylphenylnaphtho<2,3-b>furan-4,9-dion |