5-bromo-2-ethylbenzo[a]anthracene-7,12-dione structure
|
Common Name | 5-bromo-2-ethylbenzo[a]anthracene-7,12-dione | ||
|---|---|---|---|---|
| CAS Number | 62452-70-4 | Molecular Weight | 365.22000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H13BrO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-bromo-2-ethylbenzo[a]anthracene-7,12-dione |
|---|
| Molecular Formula | C20H13BrO2 |
|---|---|
| Molecular Weight | 365.22000 |
| Exact Mass | 364.01000 |
| PSA | 34.14000 |
| LogP | 4.94010 |
| InChIKey | FAIOOMNANAILIQ-UHFFFAOYSA-N |
| SMILES | CCc1ccc2c(Br)cc3c(c2c1)C(=O)c1ccccc1C3=O |
|
~%
5-bromo-2-ethyl... CAS#:62452-70-4 |
| Literature: Otsuki,T. Bulletin of the Chemical Society of Japan, 1976 , vol. 49, p. 3713 - 3714 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |