Methyl 2-chloro-4-quinolinecarboxylate structure
|
Common Name | Methyl 2-chloro-4-quinolinecarboxylate | ||
|---|---|---|---|---|
| CAS Number | 62482-26-2 | Molecular Weight | 221.640 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 338.0±22.0 °C at 760 mmHg | |
| Molecular Formula | C11H8ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.2±22.3 °C | |
| Name | Methyl 2-chloroquinoline-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 338.0±22.0 °C at 760 mmHg |
| Molecular Formula | C11H8ClNO2 |
| Molecular Weight | 221.640 |
| Flash Point | 158.2±22.3 °C |
| Exact Mass | 221.024353 |
| PSA | 39.19000 |
| LogP | 2.98 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.624 |
| InChIKey | TZKVCCWVZWZXKK-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(Cl)nc2ccccc12 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933499090 |
|
~%
Methyl 2-chloro... CAS#:62482-26-2 |
| Literature: EP2325181 A1, ; Page/Page column 61 ; |
|
~%
Methyl 2-chloro... CAS#:62482-26-2 |
| Literature: US2002/161004 A1, ; |
|
~32%
Methyl 2-chloro... CAS#:62482-26-2 |
| Literature: Feldman, Ken S.; Coca, Adiel Tetrahedron Letters, 2008 , vol. 49, # 13 p. 2136 - 2138 |
|
~%
Methyl 2-chloro... CAS#:62482-26-2 |
| Literature: US5789408 A1, ; |
|
~%
Methyl 2-chloro... CAS#:62482-26-2 |
| Literature: Chemische Berichte, , vol. 39, p. 1904 |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| HMS2728A12 |
| 4-Quinolinecarboxylic acid, 2-chloro-, methyl ester |
| 2-chloro-4-quinolinecarboxylic acid methyl ester |
| Methyl 2-chloro-4-quinolinecarboxylate |
| HMS1646M19 |
| 2-chloro-4-carbomethoxyquinoline |
| 2-Chlor-chinolin-4-carbonsaeure-methylester |
| 2-chloroquinoline-4-carboxylic acid methyl ester |