O-[4-(benzenesulfonyl)phenyl] N,N-dimethylcarbamothioate structure
|
Common Name | O-[4-(benzenesulfonyl)phenyl] N,N-dimethylcarbamothioate | ||
|---|---|---|---|---|
| CAS Number | 62489-02-5 | Molecular Weight | 321.41500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H15NO3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | O-[4-(benzenesulfonyl)phenyl] N,N-dimethylcarbamothioate |
|---|
| Molecular Formula | C15H15NO3S2 |
|---|---|
| Molecular Weight | 321.41500 |
| Exact Mass | 321.04900 |
| PSA | 87.08000 |
| LogP | 3.82550 |
| InChIKey | YIRHTVLWTZWRNO-UHFFFAOYSA-N |
| SMILES | CN(C)C(=S)Oc1ccc(S(=O)(=O)c2ccccc2)cc1 |
|
~69%
O-[4-(benzenesu... CAS#:62489-02-5 |
| Literature: The United States of America as represented by the Secretary of the Navy Patent: US4082793 A1, 1978 ; |
| Precursor 2 | |
|---|---|
| DownStream 1 | |