4-(benzenesulfonyl)phenol structure
|
Common Name | 4-(benzenesulfonyl)phenol | ||
|---|---|---|---|---|
| CAS Number | 7402-69-9 | Molecular Weight | 234.27100 | |
| Density | 1.329g/cm3 | Boiling Point | 441ºC at 760 mmHg | |
| Molecular Formula | C12H10O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.5ºC | |
| Name | 4-(benzenesulfonyl)phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.329g/cm3 |
|---|---|
| Boiling Point | 441ºC at 760 mmHg |
| Molecular Formula | C12H10O3S |
| Molecular Weight | 234.27100 |
| Flash Point | 220.5ºC |
| Exact Mass | 234.03500 |
| PSA | 62.75000 |
| LogP | 3.30580 |
| Index of Refraction | 1.618 |
| InChIKey | JSUKRBMPOXGCPR-UHFFFAOYSA-N |
| SMILES | O=S(=O)(c1ccccc1)c1ccc(O)cc1 |
| HS Code | 2908999090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 2 | |
| HS Code | 2908999090 |
|---|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| p-hydroxyphenyl p-tolyl sulfone |
| 4-benzenesulfonyl-phenol |
| 4-(phenylsulfonyl)phenol |
| 4-phenylsulfonyl-1-hydroxybenzene |
| (4-hydroxybenzenesulphonyl)-benzene |
| 1-(benzenesulfonyl)phenol |