Phenol,4-[2-[4-(2-phenyldiazenyl)phenyl]diazenyl]- structure
|
Common Name | Phenol,4-[2-[4-(2-phenyldiazenyl)phenyl]diazenyl]- | ||
|---|---|---|---|---|
| CAS Number | 6250-23-3 | Molecular Weight | 302.33000 | |
| Density | 1.19 g/cm3 | Boiling Point | 479.3ºC at 760 mmHg | |
| Molecular Formula | C18H14N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.7ºC | |
| Name | p-[[p-(phenylazo)phenyl]azo]phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.19 g/cm3 |
|---|---|
| Boiling Point | 479.3ºC at 760 mmHg |
| Molecular Formula | C18H14N4O |
| Molecular Weight | 302.33000 |
| Flash Point | 243.7ºC |
| Exact Mass | 302.11700 |
| PSA | 69.67000 |
| LogP | 6.22300 |
| Index of Refraction | 1.638 |
| InChIKey | RTZYVAQWQXPIAC-UHFFFAOYSA-N |
| SMILES | Oc1ccc(N=Nc2ccc(N=Nc3ccccc3)cc2)cc1 |
| Storage condition | 2-8°C |
|
~73%
Phenol,4-[2-[4-... CAS#:6250-23-3 |
| Literature: Odabasoglu, Mustafa; Cakmak, Suekriye; Turgut, Guenseli; Icbudak, Hasan Phosphorus, Sulfur and Silicon and the Related Elements, 2003 , vol. 178, # 3 p. 549 - 558 |
|
~%
Phenol,4-[2-[4-... CAS#:6250-23-3 |
| Literature: Atti della Accademia Nazionale dei Lincei, Classe di Scienze Fisiche, Matematiche e Naturali, Rendiconti, , vol. <5>22 I, p. 849 |
|
~%
Phenol,4-[2-[4-... CAS#:6250-23-3 |
| Literature: Atti della Accademia Nazionale dei Lincei, Classe di Scienze Fisiche, Matematiche e Naturali, Rendiconti, , vol. <5>22 I, p. 849 |
|
~%
Phenol,4-[2-[4-... CAS#:6250-23-3 |
| Literature: Chemische Berichte, , vol. 10, p. 2230 Chem. Zentralbl., , vol. 49, p. 558 |
| 4-[4-(Phenylazo)phenylazo]phenol |
| C.I. Disperse yellow 23 |
| 4-hydroxybisazobenzene |
| p-[p-phenylazophenylazo]phenol |
| 4-[[4-(phenylazo)phenyl]azo]-pheno |
| Esterquinone Light Yellow 3RLL |
| 4-hydroxy-4'-benzenazoazobenzene |
| Disperse golden yellow E-3RL |
| Laytl Yellow 4RL |
| 4-hydroxyphenylazo-4-(4-phenylazo)benzene |
| 4-<p-(phenylazo)-phenylazo>-phenol |
| 4-(4-Hydroxyphenylazo)-azobenzen |
| 4'-(Phenylazo)azobenzene-4-ol |
| Terasil Golden Yellow R |