methyl 7-(trifluoromethyl)-1,2,3,4-tetrahydroisoquinoline-5-carboxylate structure
|
Common Name | methyl 7-(trifluoromethyl)-1,2,3,4-tetrahydroisoquinoline-5-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 625128-74-7 | Molecular Weight | 259.22400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12F3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 7-(trifluoromethyl)-1,2,3,4-tetrahydroisoquinoline-5-carboxylate |
|---|
| Molecular Formula | C12H12F3NO2 |
|---|---|
| Molecular Weight | 259.22400 |
| Exact Mass | 259.08200 |
| PSA | 38.33000 |
| LogP | 2.46650 |
| InChIKey | KNVGHXLEFWBACF-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(C(F)(F)F)cc2c1CCNC2 |
|
~99%
methyl 7-(trifl... CAS#:625128-74-7 |
| Literature: Butora, Gabor; Goble, Stephen D.; Pastemak, Alexander; Yang, Lihu; Zhou, Changyou; Moyes, Christopher R. Patent: US2008/81803 A1, 2008 ; Location in patent: Page/Page column 41 ; US 20080081803 A1 |
|
~99%
methyl 7-(trifl... CAS#:625128-74-7 |
| Literature: MERCK and CO., INC.; MERCK SHARP and DOHME LIMITED Patent: WO2004/94371 A2, 2004 ; Location in patent: Page 96 ; WO 2004/094371 A2 |