2,2-Dimethoxy-3-fluoropropyl=benzoate structure
|
Common Name | 2,2-Dimethoxy-3-fluoropropyl=benzoate | ||
|---|---|---|---|---|
| CAS Number | 62522-69-4 | Molecular Weight | 242.24400 | |
| Density | 1.144g/cm3 | Boiling Point | 273.1ºC at 760 mmHg | |
| Molecular Formula | C12H15FO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 115.4ºC | |
| Name | (3-fluoro-2,2-dimethoxypropyl) benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.144g/cm3 |
|---|---|
| Boiling Point | 273.1ºC at 760 mmHg |
| Molecular Formula | C12H15FO4 |
| Molecular Weight | 242.24400 |
| Flash Point | 115.4ºC |
| Exact Mass | 242.09500 |
| PSA | 44.76000 |
| LogP | 1.80200 |
| Index of Refraction | 1.48 |
| InChIKey | VWKVIUQVIQYURO-UHFFFAOYSA-N |
| SMILES | COC(CF)(COC(=O)c1ccccc1)OC |
|
~%
2,2-Dimethoxy-3... CAS#:62522-69-4 |
| Literature: Pero,R.W. et al. Journal of Medicinal Chemistry, 1977 , vol. 20, p. 644 - 647 |
|
~%
2,2-Dimethoxy-3... CAS#:62522-69-4 |
| Literature: Pero,R.W. et al. Journal of Medicinal Chemistry, 1977 , vol. 20, p. 644 - 647 |
| 1-Benzoyloxy-2,2-dimethoxy-3-fluoropropane |
| 1-benzoyloxy-3-fluoro-2,2-dimethoxy-propane |
| BENZOIC ACID,2,2-DIMETHOXY-3-FLUOROPROPYL ESTER |
| 3-fluoro-2,2-dimethoxypropyl benzoate |
| Fluorohydroxyacetonedimethyl ketal benzoate |