4-methyl-2-pyridin-3-yl-1,3-thiazole-5-carbonyl chloride
4-methyl-2-pyridin-3-yl-1,3-thiazole-5-carbonyl chloride structure
|
Common Name | 4-methyl-2-pyridin-3-yl-1,3-thiazole-5-carbonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 62529-67-3 | Molecular Weight | 238.69300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H7ClN2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-methyl-2-pyridin-3-yl-1,3-thiazole-5-carbonyl chloride |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H7ClN2OS |
|---|---|
| Molecular Weight | 238.69300 |
| Exact Mass | 237.99700 |
| PSA | 71.09000 |
| LogP | 2.89250 |
| InChIKey | NSKIGUHWLDRNQL-UHFFFAOYSA-N |
| SMILES | Cc1nc(-c2cccnc2)sc1C(=O)Cl |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
4-methyl-2-pyri... CAS#:62529-67-3 |
| Literature: SIRTRIS PHARMACEUTICALS, INC. Patent: WO2008/156866 A1, 2008 ; Location in patent: Page/Page column 71 ; WO 2008/156866 A1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-methyl-2-pyridin-3-yl--thiazol-5-carboxylic acid chloride |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 4-methyl-2-pyridin-3-yl-1,3-thiazole-5-carbonyl chloride have? |
| A: English synonyms of 4-methyl-2-pyridin-3-yl-1,3-thiazole-5-carbonyl chloride: 4-methyl-2-pyridin-3-yl--thiazol-5-carboxylic acid chloride. |
| Q: What is the English name of 4-methyl-2-pyridin-3-yl-1,3-thiazole-5-carbonyl chloride? |
| A: The English name of 4-methyl-2-pyridin-3-yl-1,3-thiazole-5-carbonyl chloride is 4-methyl-2-pyridin-3-yl-1,3-thiazole-5-carbonyl chloride. |
| Q: What is the InChIKey of 4-methyl-2-pyridin-3-yl-1,3-thiazole-5-carbonyl chloride? |
| A: InChIKey of 4-methyl-2-pyridin-3-yl-1,3-thiazole-5-carbonyl chloride is NSKIGUHWLDRNQL-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 4-methyl-2-pyridin-3-yl-1,3-thiazole-5-carbonyl chloride? |
| A: Molecular weight of 4-methyl-2-pyridin-3-yl-1,3-thiazole-5-carbonyl chloride is 238.69300. |
| Q: What is the SMILES notation of 4-methyl-2-pyridin-3-yl-1,3-thiazole-5-carbonyl chloride? |
| A: SMILES notation of 4-methyl-2-pyridin-3-yl-1,3-thiazole-5-carbonyl chloride is Cc1nc(-c2cccnc2)sc1C(=O)Cl. |
| Q: What are the upstream materials of 4-methyl-2-pyridin-3-yl-1,3-thiazole-5-carbonyl chloride? |
| A: Related upstream materials(CAS) of 4-methyl-2-pyridin-3-yl-1,3-thiazole-5-carbonyl chloride: 39091-01-5. |
| Q: What is the polar surface area (PSA) of 4-methyl-2-pyridin-3-yl-1,3-thiazole-5-carbonyl chloride? |
| A: Polar surface area (PSA) of 4-methyl-2-pyridin-3-yl-1,3-thiazole-5-carbonyl chloride is 71.09000. |
| Q: What is the CAS number of 4-methyl-2-pyridin-3-yl-1,3-thiazole-5-carbonyl chloride? |
| A: CAS number of 4-methyl-2-pyridin-3-yl-1,3-thiazole-5-carbonyl chloride is 62529-67-3. |
| Q: What is the molecular formula of 4-methyl-2-pyridin-3-yl-1,3-thiazole-5-carbonyl chloride? |
| A: Molecular formula of 4-methyl-2-pyridin-3-yl-1,3-thiazole-5-carbonyl chloride is C10H7ClN2OS. |
| Q: What is the LogP of 4-methyl-2-pyridin-3-yl-1,3-thiazole-5-carbonyl chloride? |
| A: LogP of 4-methyl-2-pyridin-3-yl-1,3-thiazole-5-carbonyl chloride is 2.89250. |