4-Methyl-2-pyrid-3-ylthiazole-5-carboxylic acid structure
|
Common Name | 4-Methyl-2-pyrid-3-ylthiazole-5-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 39091-01-5 | Molecular Weight | 220.248 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 459.0±55.0 °C at 760 mmHg | |
| Molecular Formula | C10H8N2O2S | Melting Point | 244-248 °C (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | 231.4±31.5 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-methyl-2-pyridin-3-yl-1,3-thiazole-5-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 459.0±55.0 °C at 760 mmHg |
| Melting Point | 244-248 °C (dec.)(lit.) |
| Molecular Formula | C10H8N2O2S |
| Molecular Weight | 220.248 |
| Flash Point | 231.4±31.5 °C |
| Exact Mass | 220.030655 |
| PSA | 91.32000 |
| LogP | 2.30 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.636 |
| InChIKey | CJLQNROYBZEUGH-UHFFFAOYSA-N |
| SMILES | Cc1nc(-c2cccnc2)sc1C(=O)O |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2934100090 |
|
~97%
4-Methyl-2-pyri... CAS#:39091-01-5 |
| Literature: Harrison; William A.; Hubbard; Winchester L.; Grahame, Jr.; Robert E. Patent: US4080457 A1, 1978 ; |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 4-methyl-2-pyridin-3-yl-1,3-thiazole-5-carboxylic acid |
| 4-methyl-2-(pyridin-3-yl)-5-thiazolecarboxylic acid |
| 2-(3-Pyridyl)-4-methylthiazole-5-carboxylic acid |
| 4-methyl-2-(pyridin-3-yl)thiazole-5-carboxylic acid |
| 4-METHYL-2-(3-PYRIDINYL)-1,3-THIAZOLE-5-CARBOXYLIC ACID |
| 4-methyl-2-(pyridin-3-yl)-1,3-thiazole-5-carboxylic acid |
| 4-methyl-2-(3-pyridyl)-1,3-thiazole-5-carboxylic acid |
| MFCD00171753 |
| 2-(3-pyridyl)-4-methyl-1,3-thiazole-5-carboxylic acid |
| 4-Methyl-2-pyrid-3-ylthiazole-5-carboxylic acid |
| 4-methyl-2-(3-pyridyl)-5-thiazolecarboxylic acid |
| 4-Methyl-2-pyridin-3-yl-thiazole-5-carboxylic acid |
| 5-Thiazolecarboxylic acid, 4-methyl-2-(3-pyridinyl)- |