7-methoxy-9H-pyrido[3,4-b]indole
![7-methoxy-9H-pyrido[3,4-b]indole Structure](https://image.chemsrc.com/caspic/308/6253-19-6.png)
7-methoxy-9H-pyrido[3,4-b]indole structure
|
Common Name | 7-methoxy-9H-pyrido[3,4-b]indole | ||
|---|---|---|---|---|
| CAS Number | 6253-19-6 | Molecular Weight | 198.22100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H10N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 7-methoxy-9H-pyrido[3,4-b]indole |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H10N2O |
|---|---|
| Molecular Weight | 198.22100 |
| Exact Mass | 198.07900 |
| PSA | 37.91000 |
| LogP | 2.72470 |
| InChIKey | LMDPJJFWLNRVEH-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(c1)[nH]c1cnccc12 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
![1H-Pyrido[3,4-b]indole, 2,3,4,9-tetrahydro-7-methoxy structure](https://image.chemsrc.com/caspic/241/91566-22-2.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 4 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| norharmine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of 7-methoxy-9H-pyrido[3,4-b]indole? |
| A: Related upstream materials(CAS) of 7-methoxy-9H-pyrido[3,4-b]indole: 91566-22-2;298-12-4;3610-36-4;562-54-9. |
| Q: What is the SMILES notation of 7-methoxy-9H-pyrido[3,4-b]indole? |
| A: SMILES notation of 7-methoxy-9H-pyrido[3,4-b]indole is COc1ccc2c(c1)[nH]c1cnccc12. |
| Q: What is the LogP of 7-methoxy-9H-pyrido[3,4-b]indole? |
| A: LogP of 7-methoxy-9H-pyrido[3,4-b]indole is 2.72470. |
| Q: What is the CAS number of 7-methoxy-9H-pyrido[3,4-b]indole? |
| A: CAS number of 7-methoxy-9H-pyrido[3,4-b]indole is 6253-19-6. |
| Q: What is the molecular weight of 7-methoxy-9H-pyrido[3,4-b]indole? |
| A: Molecular weight of 7-methoxy-9H-pyrido[3,4-b]indole is 198.22100. |
| Q: What English synonyms does 7-methoxy-9H-pyrido[3,4-b]indole have? |
| A: English synonyms of 7-methoxy-9H-pyrido[3,4-b]indole: norharmine. |
| Q: What is the molecular formula of 7-methoxy-9H-pyrido[3,4-b]indole? |
| A: Molecular formula of 7-methoxy-9H-pyrido[3,4-b]indole is C12H10N2O. |
| Q: What is the polar surface area (PSA) of 7-methoxy-9H-pyrido[3,4-b]indole? |
| A: Polar surface area (PSA) of 7-methoxy-9H-pyrido[3,4-b]indole is 37.91000. |
| Q: What is the InChIKey of 7-methoxy-9H-pyrido[3,4-b]indole? |
| A: InChIKey of 7-methoxy-9H-pyrido[3,4-b]indole is LMDPJJFWLNRVEH-UHFFFAOYSA-N. |
| Q: What is the English name of 7-methoxy-9H-pyrido[3,4-b]indole? |
| A: The English name of 7-methoxy-9H-pyrido[3,4-b]indole is 7-methoxy-9H-pyrido[3,4-b]indole. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |