1-[4-[2-(furan-2-yl)ethenyl]phenyl]ethanone structure
|
Common Name | 1-[4-[2-(furan-2-yl)ethenyl]phenyl]ethanone | ||
|---|---|---|---|---|
| CAS Number | 62551-75-1 | Molecular Weight | 212.24400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[4-[2-(furan-2-yl)ethenyl]phenyl]ethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H12O2 |
|---|---|
| Molecular Weight | 212.24400 |
| Exact Mass | 212.08400 |
| PSA | 30.21000 |
| LogP | 3.65260 |
| InChIKey | GIOVFEHAVBHDRM-RMKNXTFCSA-N |
| SMILES | CC(=O)c1ccc(C=Cc2ccco2)cc1 |
|
~66%
1-[4-[2-(furan-... CAS#:62551-75-1 |
| Literature: Colbon, Paul; Barnard, Jonathan H.; Purdie, Mark; Mulholland, Keith; Kozhevnikov, Ivan; Xiao, Jianliang Advanced Synthesis and Catalysis, 2012 , vol. 354, # 8 p. 1395 - 1400 |
|
~%
1-[4-[2-(furan-... CAS#:62551-75-1 |
| Literature: Colbon, Paul; Barnard, Jonathan H.; Purdie, Mark; Mulholland, Keith; Kozhevnikov, Ivan; Xiao, Jianliang Advanced Synthesis and Catalysis, 2012 , vol. 354, # 8 p. 1395 - 1400 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-p-Acetylstyrylfuran |