3-methyl-1,4-dinitropyrazole
Modify Date: 2025-10-07 09:13:47
3-methyl-1,4-dinitropyrazole structure
|
Common Name | 3-methyl-1,4-dinitropyrazole | ||
|---|---|---|---|---|
| CAS Number | 62563-09-1 | Molecular Weight | 172.09900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C4H4N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-methyl-1,4-dinitropyrazole |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C4H4N4O4 |
|---|---|
| Molecular Weight | 172.09900 |
| Exact Mass | 172.02300 |
| PSA | 109.46000 |
| LogP | 1.18590 |
| InChIKey | TZMOJNIVOCPMIA-UHFFFAOYSA-N |
| SMILES | Cc1nn([N+](=O)[O-])cc1[N+](=O)[O-] |
|
~78%
3-methyl-1,4-di... CAS#:62563-09-1 |
| Literature: Buchanan, J. Grant; Harrison, Mark; Wightman, Richard H.; Harnden, Michael R. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1989 , p. 925 - 930 |
|
~%
3-methyl-1,4-di... CAS#:62563-09-1 |
| Literature: Huettel; Buechele Chemische Berichte, 1955 , vol. 88, p. 1586,1590 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-methyl-1,4-dinitro-1H-pyrazole |
| 1,4-dinitro-3-methylpyrazole |
| 1H-Pyrazole,3-methyl-1,4-dinitro |
| 3-Methyl-1,4-dinitropyrazol |
| 3-Methyl-1,4-dinitro-1H-pyrazol |