6-(2-hydroxyphenyl)-pyridazin-3(2h)-one& structure
|
Common Name | 6-(2-hydroxyphenyl)-pyridazin-3(2h)-one& | ||
|---|---|---|---|---|
| CAS Number | 62567-42-4 | Molecular Weight | 188.18300 | |
| Density | 1.33g/cm3 | Boiling Point | 333.1ºC at 760mmHg | |
| Molecular Formula | C10H8N2O2 | Melting Point | 297-302ºC(lit.) | |
| MSDS | N/A | Flash Point | 149.2ºC | |
| Name | (6E)-6-(6-oxocyclohexa-2,4-dien-1-ylidene)-1,2-dihydropyridazin-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 333.1ºC at 760mmHg |
| Melting Point | 297-302ºC(lit.) |
| Molecular Formula | C10H8N2O2 |
| Molecular Weight | 188.18300 |
| Flash Point | 149.2ºC |
| Exact Mass | 188.05900 |
| PSA | 65.98000 |
| LogP | 1.14250 |
| Index of Refraction | 1.651 |
| InChIKey | ITUVPRZRSCWUPA-UHFFFAOYSA-N |
| SMILES | O=c1ccc(-c2ccccc2O)n[nH]1 |
| Hazard Codes | Xn |
|---|---|
| Risk Phrases | 22-36/37/38 |
| Safety Phrases | 26-36 |
| WGK Germany | 3 |
| HS Code | 2933990090 |
|
~83%
6-(2-hydroxyphe... CAS#:62567-42-4 |
| Literature: Smith Kline and French Laboratories Limited Patent: US4528371 A1, 1985 ; |
|
~%
6-(2-hydroxyphe... CAS#:62567-42-4 |
| Literature: Smith Kline and French Laboratories Limited Patent: US4111935 A1, 1978 ; |
|
~%
6-(2-hydroxyphe... CAS#:62567-42-4 |
| Literature: Coates; McKillop Synthesis, 1993 , # 3 p. 334 - 342 |
|
~%
6-(2-hydroxyphe... CAS#:62567-42-4 |
| Literature: Coates; McKillop Synthesis, 1993 , # 3 p. 334 - 342 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-(2-Hydroxyphenyl)pyridazin-3(2H)-one |
| EINECS 263-598-4 |
| 6-(2-hydroxy-phenyl)-2H-pyridazin-3-one |
| 6-(2-hydroxyphenyl)-3(2H)-pyridazinone |
| F1967-0288 |
| 6-(2-hydroxyphenyl)-3-pyridazinone |
| 6-(2-hydroxyphenyl)pyridazin-3-ol |