Benzenamine,5-chloro-2-methoxy-4-nitro- structure
|
Common Name | Benzenamine,5-chloro-2-methoxy-4-nitro- | ||
|---|---|---|---|---|
| CAS Number | 6259-08-1 | Molecular Weight | 202.59500 | |
| Density | 1.452g/cm3 | Boiling Point | 400.1ºC at 760 mmHg | |
| Molecular Formula | C7H7ClN2O3 | Melting Point | 131ºC | |
| MSDS | N/A | Flash Point | 195.8ºC | |
| Name | 5-chloro-2-methoxy-4-nitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.452g/cm3 |
|---|---|
| Boiling Point | 400.1ºC at 760 mmHg |
| Melting Point | 131ºC |
| Molecular Formula | C7H7ClN2O3 |
| Molecular Weight | 202.59500 |
| Flash Point | 195.8ºC |
| Exact Mass | 202.01500 |
| PSA | 81.07000 |
| LogP | 2.94340 |
| Index of Refraction | 1.613 |
| InChIKey | POKAEVPBUOLQIY-UHFFFAOYSA-N |
| SMILES | COc1cc([N+](=O)[O-])c(Cl)cc1N |
|
~78%
Benzenamine,5-c... CAS#:6259-08-1 |
| Literature: Moreau; Robert C.; Fournier; Jean-Paul Patent: US4132786 A1, 1979 ; |
|
~%
Benzenamine,5-c... CAS#:6259-08-1 |
| Literature: Li, Gaoquan; Hasvold, Lisa A.; Tao, Zhi-Fu; Wang, Gary T.; Gwaltney II, Stephen L.; Patel, Jyoti; Kovar, Peter; Credo, Robert B.; Chen, Zehan; Zhang, Haiying; Park, Chang; Sham, Hing L.; Sowin, Thomas; Rosenberg, Saul H.; Lin, Nan-Horng Bioorganic and Medicinal Chemistry Letters, 2006 , vol. 16, # 8 p. 2293 - 2298 |
|
~%
Benzenamine,5-c... CAS#:6259-08-1 |
| Literature: Imp.Chem.Ind. Patent: US2056255 , 1932 ; Full Text Show Details Imp.Chem.Ind. Patent: GB375414 , 1931 ; |
| 5-Chlor-2-methoxy-4-nitro-anilin |
| 2-methoxy-5-chloro-4-nitroaniline |
| 5-Chloro-4-nitro-o-anisidine |
| o-Anisidine,5-chloro-4-nitro |
| 5-chloro-4-nitro-2-anisidine |
| 5-chloro-2-methoxy-4-nitro-aniline |
| 2-amino-4-chloro-5-nitroanisole |
| 5-Chlor-4-nitro-o-anisidin |