2-Amino-4-chloro-5-nitrophenol structure
|
Common Name | 2-Amino-4-chloro-5-nitrophenol | ||
|---|---|---|---|---|
| CAS Number | 6358-07-2 | Molecular Weight | 188.568 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 402.4±45.0 °C at 760 mmHg | |
| Molecular Formula | C6H5ClN2O3 | Melting Point | 225ºC | |
| MSDS | Chinese USA | Flash Point | 197.2±28.7 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-Amino-4-Chloro-5-Nitrophenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 402.4±45.0 °C at 760 mmHg |
| Melting Point | 225ºC |
| Molecular Formula | C6H5ClN2O3 |
| Molecular Weight | 188.568 |
| Flash Point | 197.2±28.7 °C |
| Exact Mass | 187.998871 |
| PSA | 92.07000 |
| LogP | 2.63 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.695 |
| InChIKey | ZARYBZGMUVAJMK-UHFFFAOYSA-N |
| SMILES | Nc1cc(Cl)c([N+](=O)[O-])cc1O |
| Stability | Stable. Incompatible with strong oxidizing agents, strong bases. |
| Water Solubility | <0.01 g/100 mL at 22 ºC |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATAMUTATION DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 + H312 + H332-H315-H319-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R20/21/22;R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | SJ5736000 |
| HS Code | 2922299090 |
|
~%
2-Amino-4-chlor... CAS#:6358-07-2 |
| Literature: DE186655 ; |
|
~%
2-Amino-4-chlor... CAS#:6358-07-2 |
| Literature: DE184689 ; |
|
~%
2-Amino-4-chlor... CAS#:6358-07-2 |
| Literature: DE186655 ; |
|
~%
2-Amino-4-chlor... CAS#:6358-07-2 |
| Literature: DE184689 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 8, p. 614 |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Design, synthesis, and biological evaluation of achiral analogs of duocarmycin SA.
Bioorg. Med. Chem. Lett. 15(1) , 177-80, (2005) The design, synthesis, as well as biochemical and biological evaluation of two novel achiral analogs of duocarmycin SA (DUMSA), 1 and 2, are described. Like CC-1065 and adozelesin, compounds 1 and 2 c... |
| EINECS 228-760-0 |
| MFCD00010300 |
| 2-Amino-4-chloro-5-nitrophenol |