2,4-dichloro-6-(trifluoromethyl)aniline structure
|
Common Name | 2,4-dichloro-6-(trifluoromethyl)aniline | ||
|---|---|---|---|---|
| CAS Number | 62593-17-3 | Molecular Weight | 230.015 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 220.0±35.0 °C at 760 mmHg | |
| Molecular Formula | C7H4Cl2F3N | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 86.8±25.9 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2,4-Dichloro-6-(trifluoromethyl)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 220.0±35.0 °C at 760 mmHg |
| Molecular Formula | C7H4Cl2F3N |
| Molecular Weight | 230.015 |
| Flash Point | 86.8±25.9 °C |
| Exact Mass | 228.967285 |
| PSA | 26.02000 |
| LogP | 4.60 |
| Vapour Pressure | 0.1±0.4 mmHg at 25°C |
| Index of Refraction | 1.519 |
| InChIKey | OCJPQZFOBGQYEA-UHFFFAOYSA-N |
| SMILES | Nc1c(Cl)cc(Cl)cc1C(F)(F)F |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | R22;R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2921420090 |
|
~%
2,4-dichloro-6-... CAS#:62593-17-3 |
| Literature: US6191309 B1, ; |
|
~%
2,4-dichloro-6-... CAS#:62593-17-3 |
| Literature: Tetrahedron, , vol. 49, # 22 p. 4809 - 4820 |
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Benzenamine, 2,4-dichloro-6-(trifluoromethyl)- |
| 2,4-dichloro-6-(trifluoromethyl)aniline |
| MFCD00174313 |