N-[3-(1,3-benzothiazol-2-yl)phenyl]-2-(4-chlorophenyl)acetamide structure
|
Common Name | N-[3-(1,3-benzothiazol-2-yl)phenyl]-2-(4-chlorophenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 6263-45-2 | Molecular Weight | 378.87500 | |
| Density | 1.366g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C21H15ClN2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[3-(1,3-benzothiazol-2-yl)phenyl]-2-(4-chlorophenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.366g/cm3 |
|---|---|
| Molecular Formula | C21H15ClN2OS |
| Molecular Weight | 378.87500 |
| Exact Mass | 378.05900 |
| PSA | 73.72000 |
| LogP | 6.44740 |
| Index of Refraction | 1.714 |
| InChIKey | GHDLVPHVGLEDAK-UHFFFAOYSA-N |
| SMILES | O=C(Cc1ccc(Cl)cc1)Nc1cccc(-c2nc3ccccc3s2)c1 |
|
~%
N-[3-(1,3-benzo... CAS#:6263-45-2 |
| Literature: Nemirovskii,V.D. et al. Journal of Organic Chemistry USSR (English Translation), 1966 , vol. 2, p. 16 - 20 Zhurnal Organicheskoi Khimii, 1966 , vol. 2, p. 19 - 25 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| N,N-Dimethyl-carbamidsaeure-<2-nitryloxy-ethylester> |