2-[[2-ethoxy-4-[(Z)-[(4-nitrophenyl)hydrazinylidene]methyl]phenoxy]methyl]benzonitrile structure
|
Common Name | 2-[[2-ethoxy-4-[(Z)-[(4-nitrophenyl)hydrazinylidene]methyl]phenoxy]methyl]benzonitrile | ||
|---|---|---|---|---|
| CAS Number | 6266-21-3 | Molecular Weight | 187.62300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H10ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(3-methylpyridin-1-ium-1-yl)acetic acid,chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H10ClNO2 |
|---|---|
| Molecular Weight | 187.62300 |
| Exact Mass | 187.04000 |
| PSA | 41.18000 |
| InChIKey | QSKNKUXXTPMRRD-UHFFFAOYSA-N |
| SMILES | Cc1ccc[n+](CC(=O)O)c1.[Cl-] |
|
~%
2-[[2-ethoxy-4-... CAS#:6266-21-3 |
| Literature: Dega-Szafran, Zofia; Kowalczyk, Iwona; Szafran, Miroslaw Bulletin of the Polish Academy of Sciences, Chemistry, 1995 , vol. 43, # 4 p. 303 - 312 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1-carboxymethyl-3-methyl-pyridinium,chloride |