5,6-dimethoxy-2-phenylindole structure
|
Common Name | 5,6-dimethoxy-2-phenylindole | ||
|---|---|---|---|---|
| CAS Number | 62663-26-7 | Molecular Weight | 253.29600 | |
| Density | 0.951 g/mL at 25 °C(lit.) | Boiling Point | 223-224 °C(lit.) | |
| Molecular Formula | C16H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | >230 °F | |
| Name | 5,6-dimethoxy-2-phenyl-1H-indole |
|---|---|
| Synonym | More Synonyms |
| Density | 0.951 g/mL at 25 °C(lit.) |
|---|---|
| Boiling Point | 223-224 °C(lit.) |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.29600 |
| Flash Point | >230 °F |
| Exact Mass | 253.11000 |
| PSA | 34.25000 |
| LogP | 3.85210 |
| Index of Refraction | n20/D 1.442(lit.) |
| InChIKey | VXTHRFKFXIWSTO-UHFFFAOYSA-N |
| SMILES | COc1cc2cc(-c3ccccc3)[nH]c2cc1OC |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R36/37/38:Irritating to eyes, respiratory system and skin . |
| Safety Phrases | S26-S36 |
| WGK Germany | 3 |
| RTECS | MB7660000 |
| HS Code | 2933990090 |
|
~%
5,6-dimethoxy-2... CAS#:62663-26-7 |
| Literature: Chemical Communications, , vol. 49, # 74 p. 8196 - 8198 |
|
~%
5,6-dimethoxy-2... CAS#:62663-26-7 |
| Literature: Chemical Communications, , vol. 49, # 74 p. 8196 - 8198 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD00798603 |
| 5,6-dimethoxy-2-phenyl-indole |
| 1H-Indole,5,6-dimethoxy-2-phenyl |