tert-butyl 2-[4-(2-tert-butylperoxy-2-oxoethyl)phenyl]ethaneperoxoate structure
|
Common Name | tert-butyl 2-[4-(2-tert-butylperoxy-2-oxoethyl)phenyl]ethaneperoxoate | ||
|---|---|---|---|---|
| CAS Number | 62667-40-7 | Molecular Weight | 338.39500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H26O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tert-butyl 2-[4-(2-tert-butylperoxy-2-oxoethyl)phenyl]ethaneperoxoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H26O6 |
|---|---|
| Molecular Weight | 338.39500 |
| Exact Mass | 338.17300 |
| PSA | 71.06000 |
| LogP | 3.31820 |
| InChIKey | OPEQIIJYSHZHJR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OOC(=O)Cc1ccc(CC(=O)OOC(C)(C)C)cc1 |
|
~%
tert-butyl 2-[4... CAS#:62667-40-7 |
| Literature: Lai,L.-F.; Tidwell,T.T. Journal of the American Chemical Society, 1977 , vol. 99, # 5 p. 1465 - 1470 |
| 1.4-Benzoldiperessigsaeure-tert.-butylester |
| 1,4-Benzenediethaneperoxoic acid,bis(1,1-dimethylethyl) ester |