1,4-bis[(2-methylpropan-2-yl)oxymethyl]benzene structure
|
Common Name | 1,4-bis[(2-methylpropan-2-yl)oxymethyl]benzene | ||
|---|---|---|---|---|
| CAS Number | 62667-43-0 | Molecular Weight | 250.37600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H26O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,4-bis[(2-methylpropan-2-yl)oxymethyl]benzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H26O2 |
|---|---|
| Molecular Weight | 250.37600 |
| Exact Mass | 250.19300 |
| PSA | 18.46000 |
| LogP | 4.31680 |
| InChIKey | RKACMXBDPXRJEK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OCc1ccc(COC(C)(C)C)cc1 |
|
~%
1,4-bis[(2-meth... CAS#:62667-43-0 |
| Literature: Lai,L.-F.; Tidwell,T.T. Journal of the American Chemical Society, 1977 , vol. 99, # 5 p. 1465 - 1470 |
|
~33%
1,4-bis[(2-meth... CAS#:62667-43-0 |
| Literature: Eissler, Stefan; Bogner, Tobias; Nahrwold, Markus; Sewald, Norbert Chemistry - A European Journal, 2009 , vol. 15, # 42 p. 11273 - 11287 |
| p-Di-(tert.-butoxymethyl)-benzol |
| Benzene,1,4-bis[(1,1-dimethylethoxy)methyl] |