Benzenedecanoic acid,4-acetyl-i-methyl-, methyl ester
Modify Date: 2025-10-29 12:39:37
Benzenedecanoic acid,4-acetyl-i-methyl-, methyl ester structure
|
Common Name | Benzenedecanoic acid,4-acetyl-i-methyl-, methyl ester | ||
|---|---|---|---|---|
| CAS Number | 6268-59-3 | Molecular Weight | 318.45000 | |
| Density | 0.985g/cm3 | Boiling Point | 426ºC at 760mmHg | |
| Molecular Formula | C20H30O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 183ºC | |
| Name | methyl 10-(4-acetylphenyl)undecanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.985g/cm3 |
|---|---|
| Boiling Point | 426ºC at 760mmHg |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.45000 |
| Flash Point | 183ºC |
| Exact Mass | 318.21900 |
| PSA | 43.37000 |
| LogP | 5.28650 |
| Index of Refraction | 1.493 |
| InChIKey | YFSXQBFADGXLJI-UHFFFAOYSA-N |
| SMILES | COC(=O)CCCCCCCCC(C)c1ccc(C(C)=O)cc1 |
|
~%
Benzenedecanoic... CAS#:6268-59-3 |
| Literature: Freedman et al. Journal of Organic Chemistry, 1958 , vol. 23, p. 76,81 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 10-(4-acetyl-phenyl)-undecanoic acid methyl ester |
| 10-(4-Acetyl-phenyl)-undecansaeure-methylester |
| Benzenedecanoic acid,4-acetyl-i-methyl-,methyl ester |