Acetamide,2-chloro-N-(2,4-dinitrophenyl)- structure
|
Common Name | Acetamide,2-chloro-N-(2,4-dinitrophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 6271-08-5 | Molecular Weight | 259.60300 | |
| Density | 1.647g/cm3 | Boiling Point | 486.7ºC at 760 mmHg | |
| Molecular Formula | C8H6ClN3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 248.1ºC | |
| Name | 2-chloro-N-(2,4-dinitrophenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.647g/cm3 |
|---|---|
| Boiling Point | 486.7ºC at 760 mmHg |
| Molecular Formula | C8H6ClN3O5 |
| Molecular Weight | 259.60300 |
| Flash Point | 248.1ºC |
| Exact Mass | 259.00000 |
| PSA | 120.74000 |
| LogP | 2.79970 |
| Index of Refraction | 1.664 |
| InChIKey | BJYSEWOCLXWPLH-UHFFFAOYSA-N |
| SMILES | O=C(CCl)Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| HS Code | 2924299090 |
|---|
|
~%
Acetamide,2-chl... CAS#:6271-08-5 |
| Literature: Speziale; Hamm Journal of the American Chemical Society, 1956 , vol. 78, p. 2556,2557 |
|
~%
Acetamide,2-chl... CAS#:6271-08-5 |
| Literature: Clark; Hams Biochemical Journal, 1953 , vol. 55, p. 839,842 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-chloro-n-(2,4-dinitro-phenyl)-acetamide |
| Chlor-essigsaeure-(2,4-dinitro-anilid) |
| N-Chloraceto-2,4-dinitro-anilin |
| chloro-acetic acid-(2,4-dinitro-anilide) |