N-benzyl-4-methyl-N-propyl-benzenesulfonamide structure
|
Common Name | N-benzyl-4-methyl-N-propyl-benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 6271-12-1 | Molecular Weight | 303.41900 | |
| Density | 1.145g/cm3 | Boiling Point | 442.9ºC at 760 mmHg | |
| Molecular Formula | C17H21NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.7ºC | |
| Name | N-benzyl-4-methyl-N-propylbenzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.145g/cm3 |
|---|---|
| Boiling Point | 442.9ºC at 760 mmHg |
| Molecular Formula | C17H21NO2S |
| Molecular Weight | 303.41900 |
| Flash Point | 221.7ºC |
| Exact Mass | 303.12900 |
| PSA | 45.76000 |
| LogP | 4.67670 |
| Index of Refraction | 1.573 |
| InChIKey | JEDORWVTOMYTCU-UHFFFAOYSA-N |
| SMILES | CCCN(Cc1ccccc1)S(=O)(=O)c1ccc(C)cc1 |
|
~%
N-benzyl-4-meth... CAS#:6271-12-1 |
| Literature: Carothers; Bickford; Hurwitz Journal of the American Chemical Society, 1927 , vol. 49, p. 2908 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| N-Benzyl-N-propyl-toluol-4-sulfonamid |
| N-benzyl-N-propyl-toluene-4-sulfonamide |
| p-Toluolsulfonsaeure-propylbenzylamid |