[(N-cyclohexylcarbamimidoyl)amino]-hydroxy-oxo-azanium structure
|
Common Name | [(N-cyclohexylcarbamimidoyl)amino]-hydroxy-oxo-azanium | ||
|---|---|---|---|---|
| CAS Number | 6272-68-0 | Molecular Weight | 186.21200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H14N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-cyclohexyl-1-nitroguanidine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H14N4O2 |
|---|---|
| Molecular Weight | 186.21200 |
| Exact Mass | 186.11200 |
| PSA | 93.73000 |
| LogP | 2.02950 |
| InChIKey | NRTLAKVLJIAEPB-UHFFFAOYSA-N |
| SMILES | NC(=NC1CCCCC1)N[N+](=O)[O-] |
|
~%
[(N-cyclohexylc... CAS#:6272-68-0 |
| Literature: McKay Journal of the American Chemical Society, 1949 , vol. 71, p. 1968 |
|
~%
[(N-cyclohexylc... CAS#:6272-68-0 |
| Literature: Fishbein; Gallaghan Journal of the American Chemical Society, 1954 , vol. 76, p. 1877 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| N-cyclohexyl-N'-nitro-guanidine |
| 3-Nitro-1-cyclohexyl-guanidin |