Methylnitronitrosoguanidine structure
|
Common Name | Methylnitronitrosoguanidine | ||
|---|---|---|---|---|
| CAS Number | 70-25-7 | Molecular Weight | 147.09 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 207.8±23.0 °C at 760 mmHg | |
| Molecular Formula | C2H5N5O3 | Melting Point | 118°C (dec.) | |
| MSDS | N/A | Flash Point | 79.5±22.6 °C | |
Use of MethylnitronitrosoguanidineMethylnitronitrosoguanidine (MNNG) is an alkylating agent with toxic and mutagenic effects[1]. |
| Name | N-methyl-N'-nitro-N-nitrosoguanidine |
|---|---|
| Synonym | More Synonyms |
| Description | Methylnitronitrosoguanidine (MNNG) is an alkylating agent with toxic and mutagenic effects[1]. |
|---|---|
| Related Catalog | |
| Target |
DNA Alkylator/Crosslinker[1] |
| References |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 207.8±23.0 °C at 760 mmHg |
| Melting Point | 118°C (dec.) |
| Molecular Formula | C2H5N5O3 |
| Molecular Weight | 147.09 |
| Flash Point | 79.5±22.6 °C |
| Exact Mass | 147.039246 |
| PSA | 114.37000 |
| LogP | -0.79 |
| Vapour Pressure | 0.2±0.4 mmHg at 25°C |
| Index of Refraction | 1.641 |
| InChIKey | VZUNGTLZRAYYDE-UHFFFAOYSA-N |
| SMILES | CN(N=O)C(=N)N[N+](=O)[O-] |
| Storage condition | 0-6°C |
| Water Solubility | Reacts violently |
| Hazard Codes | T:Toxic;N:Dangerousfortheenvironment; |
|---|---|
| Risk Phrases | R45;R20;R36/38;R51/53 |
| Safety Phrases | S53-S45-S61 |
| RIDADR | 2926 |
| RTECS | MF4200000 |
| Packaging Group | II |
| Hazard Class | 4.1 |
| HS Code | 2925290090 |
|
~%
Methylnitronitr... CAS#:70-25-7 |
| Literature: Journal of the American Chemical Society, , vol. 69, p. 3029 Journal of the American Chemical Society, , vol. 70, p. 1974 Journal of the American Chemical Society, , vol. 71, p. 1969 |
| Precursor 1 | |
|---|---|
| DownStream 10 | |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| guanidine, N-methyl-N''-nitro-N-nitroso- |
| 1-Methyl-3-nitro-1-nitrosoguanidine |
| MFCD00007034 |
| Guanidine, N-methyl-N'-nitro-N-nitroso- |
| Methylnitronitrosoguanidine |
| N-methyl-N'-nitro-N-nitrosoguanidine |
| 1-methyl-2-nitro-1-nitrosoguanidine |
| EINECS 200-730-1 |
| MNNG |