2-(5-bromopyridin-1-yl)-1-phenyl-ethanol structure
|
Common Name | 2-(5-bromopyridin-1-yl)-1-phenyl-ethanol | ||
|---|---|---|---|---|
| CAS Number | 6274-03-9 | Molecular Weight | 359.05600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H13Br2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(3-bromopyridin-1-ium-1-yl)-1-phenylethanol,bromide |
|---|
| Molecular Formula | C13H13Br2NO |
|---|---|
| Molecular Weight | 359.05600 |
| Exact Mass | 356.93600 |
| PSA | 24.11000 |
| InChIKey | TXNYIZWYHKFBLX-UHFFFAOYSA-M |
| SMILES | OC(C[n+]1cccc(Br)c1)c1ccccc1.[Br-] |
|
~%
2-(5-bromopyrid... CAS#:6274-03-9 |
| Literature: Bahner et al. Journal of the American Chemical Society, 1951 , vol. 73, p. 3499 |
|
~%
2-(5-bromopyrid... CAS#:6274-03-9 |
| Literature: Kroehnke Chemische Berichte, 1939 , vol. 72, p. 2000,2007 Chemische Berichte, 1935 , vol. 68, p. 1351,1355 |