3-chloro-N-(4-cyano-3-(trifluoromethyl)phenyl)-2-hydroxy-2-methylpropanamide
3-chloro-N-(4-cyano-3-(trifluoromethyl)phenyl)-2-hydroxy-2-methylpropanamide structure
|
Common Name | 3-chloro-N-(4-cyano-3-(trifluoromethyl)phenyl)-2-hydroxy-2-methylpropanamide | ||
|---|---|---|---|---|
| CAS Number | 627484-44-0 | Molecular Weight | 306.66800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H10ClF3N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 3-Chloro-N-(4-cyano-3-(trifluoromethyl)phenyl)-2-hydroxy-2-methylpropanamide (CAS number: 627484-44-0), molecular formula: C12H10ClF3N2O2, molecular weight: 306.66800. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-chloro-N-(4-cyano-3-(trifluoromethyl)phenyl)-2-hydroxy-2-methylpropanamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H10ClF3N2O2 |
|---|---|
| Molecular Weight | 306.66800 |
| Exact Mass | 306.03800 |
| PSA | 73.12000 |
| LogP | 2.57838 |
| InChIKey | SESZJEZURRRLMD-UHFFFAOYSA-N |
| SMILES | CC(O)(CCl)C(=O)Nc1ccc(C#N)c(C(F)(F)F)c1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:90357-51-0This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 3-chloro-N-(4-cyano-3-(trifluoromethyl)phenyl)-2-hydroxy-2-methylpropanamide? |
| A: Polar surface area (PSA) of 3-chloro-N-(4-cyano-3-(trifluoromethyl)phenyl)-2-hydroxy-2-methylpropanamide is 73.12000. |
| Q: What is the Chinese name of 627484-44-0? |
| A: Chinese name of 627484-44-0 is 627484-44-0. |
| Q: What is the molecular weight of 3-chloro-N-(4-cyano-3-(trifluoromethyl)phenyl)-2-hydroxy-2-methylpropanamide? |
| A: Molecular weight of 3-chloro-N-(4-cyano-3-(trifluoromethyl)phenyl)-2-hydroxy-2-methylpropanamide is 306.66800. |
| Q: What is the SMILES notation of 3-chloro-N-(4-cyano-3-(trifluoromethyl)phenyl)-2-hydroxy-2-methylpropanamide? |
| A: SMILES notation of 3-chloro-N-(4-cyano-3-(trifluoromethyl)phenyl)-2-hydroxy-2-methylpropanamide is CC(O)(CCl)C(=O)Nc1ccc(C#N)c(C(F)(F)F)c1. |
| Q: What are the downstream products of 3-chloro-N-(4-cyano-3-(trifluoromethyl)phenyl)-2-hydroxy-2-methylpropanamide? |
| A: Related downstream products(CAS) of 3-chloro-N-(4-cyano-3-(trifluoromethyl)phenyl)-2-hydroxy-2-methylpropanamide: 90357-51-0. |
| Q: What is the molecular formula of 3-chloro-N-(4-cyano-3-(trifluoromethyl)phenyl)-2-hydroxy-2-methylpropanamide? |
| A: Molecular formula of 3-chloro-N-(4-cyano-3-(trifluoromethyl)phenyl)-2-hydroxy-2-methylpropanamide is C12H10ClF3N2O2. |
| Q: What is the LogP of 3-chloro-N-(4-cyano-3-(trifluoromethyl)phenyl)-2-hydroxy-2-methylpropanamide? |
| A: LogP of 3-chloro-N-(4-cyano-3-(trifluoromethyl)phenyl)-2-hydroxy-2-methylpropanamide is 2.57838. |
| Q: What is the CAS number of 3-chloro-N-(4-cyano-3-(trifluoromethyl)phenyl)-2-hydroxy-2-methylpropanamide? |
| A: CAS number of 3-chloro-N-(4-cyano-3-(trifluoromethyl)phenyl)-2-hydroxy-2-methylpropanamide is 627484-44-0. |
| Q: What is the InChIKey of 3-chloro-N-(4-cyano-3-(trifluoromethyl)phenyl)-2-hydroxy-2-methylpropanamide? |
| A: InChIKey of 3-chloro-N-(4-cyano-3-(trifluoromethyl)phenyl)-2-hydroxy-2-methylpropanamide is SESZJEZURRRLMD-UHFFFAOYSA-N. |
| Q: What is the English name of 3-chloro-N-(4-cyano-3-(trifluoromethyl)phenyl)-2-hydroxy-2-methylpropanamide? |
| A: The English name of 3-chloro-N-(4-cyano-3-(trifluoromethyl)phenyl)-2-hydroxy-2-methylpropanamide is 3-chloro-N-(4-cyano-3-(trifluoromethyl)phenyl)-2-hydroxy-2-methylpropanamide. |