N-(4-Cyano-3-(trifluoromethyl)phenyl)-2-methyloxirane-2-carboxamide
N-(4-Cyano-3-(trifluoromethyl)phenyl)-2-methyloxirane-2-carboxamide structure
|
Common Name | N-(4-Cyano-3-(trifluoromethyl)phenyl)-2-methyloxirane-2-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 90357-51-0 | Molecular Weight | 270.207 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 436.4±45.0 °C at 760 mmHg | |
| Molecular Formula | C12H9F3N2O2 | Melting Point | 153 °C | |
| MSDS | N/A | Flash Point | 217.7±28.7 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-[4-Cyano-3-(trifluoromethyl)phenyl]methacrylamide epoxide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 436.4±45.0 °C at 760 mmHg |
| Melting Point | 153 °C |
| Molecular Formula | C12H9F3N2O2 |
| Molecular Weight | 270.207 |
| Flash Point | 217.7±28.7 °C |
| Exact Mass | 270.061615 |
| PSA | 65.42000 |
| LogP | 2.45 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.526 |
| InChIKey | UQUQTWDUTIAAAY-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)Nc2ccc(C#N)c(C(F)(F)F)c2)CO1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2926909090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 10 | |
|---|---|
| DownStream 2 | |
CAS#:7722-84-1
CAS#:90357-53-2
CAS#:38649-35-3
CAS#:143782-18-7
CAS#:2311-91-3
CAS#:654-70-6
CAS#:627484-44-0![N-[4-cyano-3-(trifluoromethyl)-phenyl]-2,3-dihydroxy-2-methyl-propionamide Structure](https://image.chemsrc.com/caspic/363/316373-92-9.png)
CAS#:316373-92-9
CAS#:194853-86-6
CAS#:90-15-3![N-[4-Cyano-3-(trifluoromethyl)phenyl]-3-[(4-fluorophenyl)thio]-2-hydroxy-2-methylpropionamide structure](https://image.chemsrc.com/caspic/376/90356-78-8.png)
CAS#:90356-78-8
CAS#:90357-06-5This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-[4-Cyan-3-(trifluormethyl)phenyl]-2-methyloxiran-2-carboxamid |
| N-(4-Cyano-3-(trifluoromethyl)phenyl)-2-methyl-oxiranecarboxamine |
| N-[4-cyano-3-(trifluoromethyl)phenyl]-2-methyl-Oxiranecarboxamide |
| N-(4-cyano-3-trifluoromethylphenyl)-2-methyl-oxiranyl-carboxamide |
| N-[4-Cyano-3-(trifluoromethyl)phenyl]-2-methyloxirane-2-carboxamide |
| rac-N-(4-cyano-3-(trifluoromethyl)phenyl)-2-methyloxirane-2-carboxamide |
| 1,2-EPOXY-2-METHYL-N-[4-CYANO-3-(TRIFLUOROMETHYL)] |
| N-[4-Cyano-3-(trifluoromethyl)phenyl]methacrylamide epoxide; (Intermediate of Bicalutamide) |
| N-(4-cyano-3-(trifluoromethyl)phenyl)-2-methyloxirane-2-carboxamide |
| N-[4-Cyano-3-(trifluoromethyl)phenyl]-2-methyl-2-oxiranecarboxamide |
| 1,2-Epoxy-2-Methyl-N[4-Cyano-3(Trifluoromethyl)-Phenyl]Propanamide |
| 1,2-Epoxy-2-methyl-N-(4-cyano-3-trifluoromethyl)-phenyl)propaneamide |
| N-[4-Cyano-3-(triflu |
| N-4-CYANO-3-(TRIFLUOROMETHYL)PHENYLMETHACRYLAMIDE EPOXIDE |
| 4-cyano-N-(2,3-epoxy-2-methylpropionyl)-3-trifluoromethylaniline |
| MFCD08460201 |
| N-[4-Cyano-3-(trifluoroMethyl)phenyl]MethacrylaMid |
| N-(4-cyano-3-trifluoromethyl-phenyl)-2-methyl-2-oxirane-propionamide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of N-[4-Cyano-3-(trifluoromethyl)phenyl]methacrylamide epoxide? |
| A: Polar surface area (PSA) of N-[4-Cyano-3-(trifluoromethyl)phenyl]methacrylamide epoxide is 65.42000. |
| Q: What is the SMILES notation of N-[4-Cyano-3-(trifluoromethyl)phenyl]methacrylamide epoxide? |
| A: SMILES notation of N-[4-Cyano-3-(trifluoromethyl)phenyl]methacrylamide epoxide is CC1(C(=O)Nc2ccc(C#N)c(C(F)(F)F)c2)CO1. |
| Q: What is the LogP of N-[4-Cyano-3-(trifluoromethyl)phenyl]methacrylamide epoxide? |
| A: LogP of N-[4-Cyano-3-(trifluoromethyl)phenyl]methacrylamide epoxide is 2.45. |
| Q: What is the molecular formula of N-[4-Cyano-3-(trifluoromethyl)phenyl]methacrylamide epoxide? |
| A: Molecular formula of N-[4-Cyano-3-(trifluoromethyl)phenyl]methacrylamide epoxide is C12H9F3N2O2. |
| Q: What is the InChIKey of N-[4-Cyano-3-(trifluoromethyl)phenyl]methacrylamide epoxide? |
| A: InChIKey of N-[4-Cyano-3-(trifluoromethyl)phenyl]methacrylamide epoxide is UQUQTWDUTIAAAY-UHFFFAOYSA-N. |
| Q: What are the downstream products of N-[4-Cyano-3-(trifluoromethyl)phenyl]methacrylamide epoxide? |
| A: Related downstream products(CAS) of N-[4-Cyano-3-(trifluoromethyl)phenyl]methacrylamide epoxide: 90356-78-8;90357-06-5. |
| Q: What is the molecular weight of N-[4-Cyano-3-(trifluoromethyl)phenyl]methacrylamide epoxide? |
| A: Molecular weight of N-[4-Cyano-3-(trifluoromethyl)phenyl]methacrylamide epoxide is 270.207. |
| Q: What is the CAS number of N-[4-Cyano-3-(trifluoromethyl)phenyl]methacrylamide epoxide? |
| A: CAS number of N-[4-Cyano-3-(trifluoromethyl)phenyl]methacrylamide epoxide is 90357-51-0. |
| Q: What is the English name of N-[4-Cyano-3-(trifluoromethyl)phenyl]methacrylamide epoxide? |
| A: The English name of N-[4-Cyano-3-(trifluoromethyl)phenyl]methacrylamide epoxide is N-[4-Cyano-3-(trifluoromethyl)phenyl]methacrylamide epoxide. |
| Q: What is the melting point of N-[4-Cyano-3-(trifluoromethyl)phenyl]methacrylamide epoxide? |
| A: Melting point of N-[4-Cyano-3-(trifluoromethyl)phenyl]methacrylamide epoxide is 153 °C. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |
| Henan Tianfu Chemical Co., Ltd. |