N-(4-Cyano-3-(trifluoromethyl)phenyl)-2-methyloxirane-2-carboxamide structure
|
Common Name | N-(4-Cyano-3-(trifluoromethyl)phenyl)-2-methyloxirane-2-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 90357-51-0 | Molecular Weight | 270.207 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 436.4±45.0 °C at 760 mmHg | |
| Molecular Formula | C12H9F3N2O2 | Melting Point | 153 °C | |
| MSDS | N/A | Flash Point | 217.7±28.7 °C | |
| Name | N-[4-Cyano-3-(trifluoromethyl)phenyl]methacrylamide epoxide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 436.4±45.0 °C at 760 mmHg |
| Melting Point | 153 °C |
| Molecular Formula | C12H9F3N2O2 |
| Molecular Weight | 270.207 |
| Flash Point | 217.7±28.7 °C |
| Exact Mass | 270.061615 |
| PSA | 65.42000 |
| LogP | 2.45 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.526 |
| InChIKey | UQUQTWDUTIAAAY-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)Nc2ccc(C#N)c(C(F)(F)F)c2)CO1 |
| HS Code | 2926909090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 2 | |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| N-[4-Cyan-3-(trifluormethyl)phenyl]-2-methyloxiran-2-carboxamid |
| N-(4-Cyano-3-(trifluoromethyl)phenyl)-2-methyl-oxiranecarboxamine |
| N-[4-cyano-3-(trifluoromethyl)phenyl]-2-methyl-Oxiranecarboxamide |
| N-(4-cyano-3-trifluoromethylphenyl)-2-methyl-oxiranyl-carboxamide |
| N-[4-Cyano-3-(trifluoromethyl)phenyl]-2-methyloxirane-2-carboxamide |
| rac-N-(4-cyano-3-(trifluoromethyl)phenyl)-2-methyloxirane-2-carboxamide |
| 1,2-EPOXY-2-METHYL-N-[4-CYANO-3-(TRIFLUOROMETHYL)] |
| N-[4-Cyano-3-(trifluoromethyl)phenyl]methacrylamide epoxide; (Intermediate of Bicalutamide) |
| N-(4-cyano-3-(trifluoromethyl)phenyl)-2-methyloxirane-2-carboxamide |
| N-[4-Cyano-3-(trifluoromethyl)phenyl]-2-methyl-2-oxiranecarboxamide |
| 1,2-Epoxy-2-Methyl-N[4-Cyano-3(Trifluoromethyl)-Phenyl]Propanamide |
| 1,2-Epoxy-2-methyl-N-(4-cyano-3-trifluoromethyl)-phenyl)propaneamide |
| N-[4-Cyano-3-(triflu |
| N-4-CYANO-3-(TRIFLUOROMETHYL)PHENYLMETHACRYLAMIDE EPOXIDE |
| 4-cyano-N-(2,3-epoxy-2-methylpropionyl)-3-trifluoromethylaniline |
| MFCD08460201 |
| N-[4-Cyano-3-(trifluoroMethyl)phenyl]MethacrylaMid |
| N-(4-cyano-3-trifluoromethyl-phenyl)-2-methyl-2-oxirane-propionamide |