2-amino-2,3-diphenyl-propanoic acid structure
|
Common Name | 2-amino-2,3-diphenyl-propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 6278-95-1 | Molecular Weight | 241.28500 | |
| Density | 1.214g/cm3 | Boiling Point | 377.6ºC at 760mmHg | |
| Molecular Formula | C15H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.2ºC | |
| Name | 2-amino-2,3-diphenylpropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.214g/cm3 |
|---|---|
| Boiling Point | 377.6ºC at 760mmHg |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.28500 |
| Flash Point | 182.2ºC |
| Exact Mass | 241.11000 |
| PSA | 63.32000 |
| LogP | 2.86820 |
| InChIKey | YMCRTUKBQGPJNL-UHFFFAOYSA-N |
| SMILES | NC(Cc1ccccc1)(C(=O)O)c1ccccc1 |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 2-amino-2,3-diphenyl-propanoic acid |