2-methyl-2,3-diphenyl-propanoic acid structure
|
Common Name | 2-methyl-2,3-diphenyl-propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 7511-43-5 | Molecular Weight | 240.29700 | |
| Density | 1.136g/cm3 | Boiling Point | 354.2ºC at 760 mmHg | |
| Molecular Formula | C16H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 251.1ºC | |
| Name | 2-methyl-2,3-diphenylpropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.136g/cm3 |
|---|---|
| Boiling Point | 354.2ºC at 760 mmHg |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.29700 |
| Flash Point | 251.1ºC |
| Exact Mass | 240.11500 |
| PSA | 37.30000 |
| LogP | 3.27160 |
| Index of Refraction | 1.583 |
| InChIKey | ZWIZUBYJTNGOPG-UHFFFAOYSA-N |
| SMILES | CC(Cc1ccccc1)(C(=O)O)c1ccccc1 |
| HS Code | 2916399090 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 1 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-METHYL-2,3-DIPHENYL-PROPANOIC ACID |
| 2-benzyl-2-phenylpropanoic acid |
| 2-Methyl-2,3-diphenyl-propionsaeure |
| 2,3-diphenyl-2-methylpropionic acid |
| Methyl-phenyl-benzyl-essigsaeure |
| 2-methyl-2,3-diphenyl-propionic acid |