egdn structure
|
Common Name | egdn | ||
|---|---|---|---|---|
| CAS Number | 628-96-6 | Molecular Weight | 152.06300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C2H4N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 35.6 °F | |
| Symbol |
GHS02, GHS07 |
Signal Word | Danger | |
| Name | 2-nitrooxyethyl nitrate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C2H4N2O6 |
|---|---|
| Molecular Weight | 152.06300 |
| Exact Mass | 152.00700 |
| PSA | 110.10000 |
| LogP | 0.44940 |
| InChIKey | UQXKXGWGFRWILX-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])OCCO[N+](=O)[O-] |
| Storage condition | ?20°C |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS02, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H225-H302 + H312 + H332-H319 |
| Precautionary Statements | P210-P261-P302 + P352 + P312-P304 + P340 + P312-P337 + P313-P403 + P235 |
| Hazard Codes | E,T+,Xn |
| Risk Phrases | 2-26/27/28-33-36-20/21/22-11-3 |
| Safety Phrases | 33-35-36/37-45-26-16 |
| RIDADR | 0473 |
| Flash Point(F) | 35.6 °F |
| Flash Point(C) | 2 °C |
| Precursor 9 | |
|---|---|
| DownStream 5 | |
|
Molecularly imprinted Au nanoparticles composites on Au surfaces for the surface plasmon resonance detection of pentaerythritol tetranitrate, nitroglycerin, and ethylene glycol dinitrate.
Anal. Chem. 83(8) , 3082-8, (2011) Molecularly imprinted Au nanoparticles (NPs) composites are generated on Au-coated glass surfaces. The imprinting process involves the electropolymerization of thioaniline-functionalized Au NPs (3.5 n... |
|
|
Sixteen year follow up of workers in an explosives factory.
J. Soc. Occup. Med. 35(4) , 107-10, (1985)
|
|
|
Application of solid-phase microextraction to the recovery of organic explosives.
J. Forensic Sci. 43(1) , 76-81, (1998) The application of solid-phase microextraction to the recovery of residues of organic explosives by headspace sampling is discussed. It was found that the technique was rapid and simple. Polydimethyls... |
| ethane-1,2-diyl dinitrate |
| 1,2-dinitrooxy-ethane |
| Ethylene glycol,dinitrate |
| dinitroethylene glycol |
| Dinitroglycol |
| EINECS 211-063-0 |
| 1,2-bis-nitrooxy-ethane |
| EGDN |
| 1,2-Ethanediol,dinitrate |
| Ethylene dinitrate |
| Nitroglycol |
| Ethanediol dinitrate |
| Ethylene nitrate |
| Glycol dinitrate |
| 1,2-ethyl dinitrate |