5-(Benzyloxy)-4-chloro-2-(chloromethyl)pyridine
Modify Date: 2025-09-22 09:13:05
5-(Benzyloxy)-4-chloro-2-(chloromethyl)pyridine structure
|
Common Name | 5-(Benzyloxy)-4-chloro-2-(chloromethyl)pyridine | ||
|---|---|---|---|---|
| CAS Number | 62811-98-7 | Molecular Weight | 268.13900 | |
| Density | 1.295g/cm3 | Boiling Point | 383.912ºC at 760 mmHg | |
| Molecular Formula | C13H11Cl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.984ºC | |
| Name | 4-chloro-2-(chloromethyl)-5-phenylmethoxypyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.295g/cm3 |
|---|---|
| Boiling Point | 383.912ºC at 760 mmHg |
| Molecular Formula | C13H11Cl2NO |
| Molecular Weight | 268.13900 |
| Flash Point | 185.984ºC |
| Exact Mass | 267.02200 |
| PSA | 22.12000 |
| LogP | 4.05280 |
| Index of Refraction | 1.593 |
| InChIKey | HKZQPUHZXRZWHR-UHFFFAOYSA-N |
| SMILES | ClCc1cc(Cl)c(OCc2ccccc2)cn1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-(Benzyloxy)-4-chloro-2-(chloromethyl)pyridine |
| benzyloxychlorochloromethylpyridine |
| 5-Benzyloxy-4-chlor-2-chlormethylpyridin |
| FD-0010 |