4-chloro-N-(3-nitrophenyl)benzamide structure
|
Common Name | 4-chloro-N-(3-nitrophenyl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 6282-15-1 | Molecular Weight | 276.67500 | |
| Density | 1.44g/cm3 | Boiling Point | 348.9ºC at 760 mmHg | |
| Molecular Formula | C13H9ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164.8ºC | |
| Name | 4-chloro-N-(3-nitrophenyl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.44g/cm3 |
|---|---|
| Boiling Point | 348.9ºC at 760 mmHg |
| Molecular Formula | C13H9ClN2O3 |
| Molecular Weight | 276.67500 |
| Flash Point | 164.8ºC |
| Exact Mass | 276.03000 |
| PSA | 74.92000 |
| LogP | 4.09670 |
| Index of Refraction | 1.676 |
| InChIKey | DZRVTHXSGBTDPB-UHFFFAOYSA-N |
| SMILES | O=C(Nc1cccc([N+](=O)[O-])c1)c1ccc(Cl)cc1 |
| HS Code | 2924299090 |
|---|
|
~87%
4-chloro-N-(3-n... CAS#:6282-15-1 |
| Literature: Arora, Revika; Paul, Satya; Gupta, Rajive Canadian Journal of Chemistry, 2005 , vol. 83, # 8 p. 1137 - 1140 |
|
~%
4-chloro-N-(3-n... CAS#:6282-15-1 |
| Literature: Takatori Yakugaku Zasshi, 1953 , vol. 73, p. 810,811 Chem.Abstr., 1954 , p. 8749 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-chloro-benzoic acid-(3-nitro-anilide) |
| benzamide,4-chloro-n-(3-nitrophenyl) |
| 4-Chlor-benzoesaeure-(3-nitro-anilid) |